EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17ClN3O3P |
| Net Charge | 0 |
| Average Mass | 413.801 |
| Monoisotopic Mass | 413.06961 |
| SMILES | CO[P@](=O)(c1cc(C)cc(/C=C/C#N)c1)c1c(C(N)=O)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H17ClN3O3P/c1-12-8-13(4-3-7-22)10-15(9-12)28(26,27-2)19-16-11-14(21)5-6-17(16)24-18(19)20(23)25/h3-6,8-11,24H,1-2H3,(H2,23,25)/b4-3+/t28-/m1/s1 |
| InChIKey | CGBYTKOSZYQOPV-ASSBYYIWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosdevirine (CHEBI:229854) is a indolecarboxamide (CHEBI:46921) |
| fosdevirine (CHEBI:229854) is a indolyl carboxylic acid (CHEBI:46867) |
| fosdevirine (CHEBI:229854) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 5-chloro-3-[[3-[(E)-2-cyanoethenyl]-5-methylphenyl]-methoxyphosphoryl]-1H-indole-2-carboxamide |
| INNs | Source |
|---|---|
| fosdevirina | WHO MedNet |
| fosdevirine | WHO MedNet |
| Synonyms | Source |
|---|---|
| GSK-2248761 | ChEMBL |
| GSK 2248761A | ChEMBL |
| GSK-2248761A | ChEMBL |
| GSK2248761A | ChEMBL |
| IDX-899 | ChEMBL |
| IDX899 | ChEMBL |
| Citations |
|---|