EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N6O4 |
| Net Charge | 0 |
| Average Mass | 376.417 |
| Monoisotopic Mass | 376.18590 |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H24N6O4/c1-2-18-16(26)13-11(24)12(25)17(27-13)23-8-21-10-14(19-7-20-15(10)23)22-9-5-3-4-6-9/h7-9,11-13,17,24-25H,2-6H2,1H3,(H,18,26)(H,19,20,22)/t11-,12+,13-,17+/m0/s1 |
| InChIKey | GWVQGVCXFNYGFP-PFHKOEEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selodenoson (CHEBI:229849) has role anti-arrhythmia drug (CHEBI:38070) |
| selodenoson (CHEBI:229849) is a purine nucleoside (CHEBI:26394) |
| IUPAC Name |
|---|
| (2S,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| INN | Source |
|---|---|
| selodenoson | WHO MedNet |
| Synonyms | Source |
|---|---|
| DTI-0009 | ChEMBL |
| GR-56072 | ChEMBL |
| GR56072 | ChEMBL |
| RG-14202 | ChEMBL |