EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14Br2O2 |
| Net Charge | 0 |
| Average Mass | 314.017 |
| Monoisotopic Mass | 311.93605 |
| SMILES | CCCCCCC(C(=O)O)=C(Br)Br |
| InChI | InChI=1S/C9H14Br2O2/c1-2-3-4-5-6-7(8(10)11)9(12)13/h2-6H2,1H3,(H,12,13) |
| InChIKey | MFKDPSRYICTYKE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3-dibromo-2-n-hexylacrylic acid (CHEBI:229848) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 2-(dibromomethylidene)octanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368337 | ChemSpider |
| LMFA01090083 | LIPID MAPS |