EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O8S |
| Net Charge | 0 |
| Average Mass | 304.276 |
| Monoisotopic Mass | 304.02529 |
| SMILES | COc1cc(/C=C/C(=O)O)cc(OC)c1OS(=O)(=O)O |
| InChI | InChI=1S/C11H12O8S/c1-17-8-5-7(3-4-10(12)13)6-9(18-2)11(8)19-20(14,15)16/h3-6H,1-2H3,(H,12,13)(H,14,15,16)/b4-3+ |
| InChIKey | KJWQVTFGBFEXMV-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sinapic acid 4-o-sulfate (CHEBI:229825) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(3,5-dimethoxy-4-sulooxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28554517 | ChemSpider |
| HMDB0060020 | HMDB |