EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O5 |
| Net Charge | 0 |
| Average Mass | 446.628 |
| Monoisotopic Mass | 446.30322 |
| SMILES | CC(C)CC[C@H](O)[C@](C)(O)[C@H]1CCC2C3=CC(=O)C4=C[C@H](O)[C@@H](O)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H42O5/c1-15(2)6-9-24(31)27(5,32)23-8-7-17-16-12-20(28)19-13-21(29)22(30)14-26(19,4)18(16)10-11-25(17,23)3/h12-13,15,17-18,21-24,29-32H,6-11,14H2,1-5H3/t17?,18?,21-,22-,23-,24-,25-,26+,27+/m0/s1 |
| InChIKey | NBEQHHTVOOYUFN-ORTBPADBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinnasterol (CHEBI:229822) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (2S,3S,10R,13S,17S)-17-[(2R,3S)-2,3-dihydroxy-6-methylheptan-2-yl]-2,3-dihydroxy-10,13-dimethyl-1,2,3,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-one |
| Manual Xrefs | Databases |
|---|---|
| LMST01010283 | LIPID MAPS |