EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O2 |
| Net Charge | 0 |
| Average Mass | 234.339 |
| Monoisotopic Mass | 234.16198 |
| SMILES | O=C(O)CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C15H22O2/c16-15(17)13-9-4-2-1-3-6-10-14-11-7-5-8-12-14/h5,7-8,11-12H,1-4,6,9-10,13H2,(H,16,17) |
| InChIKey | URWLWLXGACJYCO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-phenyl nonanoic acid (CHEBI:229821) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 9-phenylnonanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2540927 | ChemSpider |
| LMFA01140064 | LIPID MAPS |