EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N4O2 |
| Net Charge | 0 |
| Average Mass | 194.194 |
| Monoisotopic Mass | 194.08038 |
| SMILES | Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 |
| InChIKey | RYYVLZVUVIJVGH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | PubMed (18068204) | |
| Claviceps sorghicola (ncbitaxon:83213) | - | DOI (10.1016/S0031-9422(00)00169-2) | |
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS90) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Theobroma cacao (ncbitaxon:3641) | - | DOI (10.1016/S0031-9422(00)00169-2) |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. food additive Any substance which is added to food to preserve or enhance its flavour and/or appearance. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. adenosine A2A receptor antagonist An antagonist at the A2A receptor. adenosine receptor antagonist An antagonist at any adenosine receptor. ryanodine receptor agonist A ryanodine receptor modulator which activates the receptor. Ryanodine receptors (RyRs) act as selective ion channels, modulating the release of calcium. Activating the receptors causes the release of calcium, so depleting internal calcium and ultimately preventing further muscle contraction. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. food additive Any substance which is added to food to preserve or enhance its flavour and/or appearance. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. adjuvant Any pharmacological or immunological agent that modifies the effect of other agents such as drugs or vaccines while having few if any direct effects when given by itself. central nervous system stimulant Any drug that enhances the activity of the central nervous system. food additive Any substance which is added to food to preserve or enhance its flavour and/or appearance. diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caffeine (CHEBI:27732) has role adenosine A2A receptor antagonist (CHEBI:53121) |
| caffeine (CHEBI:27732) has role adenosine receptor antagonist (CHEBI:71232) |
| caffeine (CHEBI:27732) has role adjuvant (CHEBI:60809) |
| caffeine (CHEBI:27732) has role central nervous system stimulant (CHEBI:35337) |
| caffeine (CHEBI:27732) has role diuretic (CHEBI:35498) |
| caffeine (CHEBI:27732) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| caffeine (CHEBI:27732) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| caffeine (CHEBI:27732) has role environmental contaminant (CHEBI:78298) |
| caffeine (CHEBI:27732) has role food additive (CHEBI:64047) |
| caffeine (CHEBI:27732) has role fungal metabolite (CHEBI:76946) |
| caffeine (CHEBI:27732) has role geroprotector (CHEBI:176497) |
| caffeine (CHEBI:27732) has role human blood serum metabolite (CHEBI:85234) |
| caffeine (CHEBI:27732) has role mouse metabolite (CHEBI:75771) |
| caffeine (CHEBI:27732) has role mutagen (CHEBI:25435) |
| caffeine (CHEBI:27732) has role plant metabolite (CHEBI:76924) |
| caffeine (CHEBI:27732) has role psychotropic drug (CHEBI:35471) |
| caffeine (CHEBI:27732) has role ryanodine receptor agonist (CHEBI:67114) |
| caffeine (CHEBI:27732) has role xenobiotic (CHEBI:35703) |
| caffeine (CHEBI:27732) is a purine alkaloid (CHEBI:26385) |
| caffeine (CHEBI:27732) is a trimethylxanthine (CHEBI:27134) |
| Incoming Relation(s) |
| 8-(3-chlorostyryl)caffeine (CHEBI:53115) has functional parent caffeine (CHEBI:27732) |
| caffeine monohydrate (CHEBI:31332) has part caffeine (CHEBI:27732) |
| sodium caffeine benzoate (CHEBI:32140) has part caffeine (CHEBI:27732) |
| IUPAC Name |
|---|
| 1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione |
| Synonyms | Source |
|---|---|
| 1,3,7-trimethyl-2,6-dioxopurine | ChemIDplus |
| 1,3,7-trimethylpurine-2,6-dione | IUPHAR |
| 1,3,7-trimethylxanthine | NIST Chemistry WebBook |
| 1,3,7-Trimethylxanthine | KEGG COMPOUND |
| 1-methyltheobromine | ChemIDplus |
| 3,7-Dihydro-1,3,7-trimethyl-1H-purin-2,6-dion | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| caffeine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1-3-7-TRIMETHYLXANTHINE | MetaCyc |
| 463 | DrugCentral |
| C00001492 | KNApSAcK |
| C07481 | KEGG COMPOUND |
| Caffeine | Wikipedia |
| CFF | PDBeChem |
| D00528 | KEGG DRUG |
| DB00201 | DrugBank |
| HMDB0001847 | HMDB |
| LSM-2026 | LINCS |
| Citations |
|---|