EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O4 |
| Net Charge | 0 |
| Average Mass | 338.488 |
| Monoisotopic Mass | 338.24571 |
| SMILES | CCCCCC=CCC=CCC(O)C(O)CC=CCCCC(=O)O |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-6-7-8-9-12-15-18(21)19(22)16-13-10-11-14-17-20(23)24/h6-7,9-10,12-13,18-19,21-22H,2-5,8,11,14-17H2,1H3,(H,23,24) |
| InChIKey | DCJBINATHQHPKO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+/-)8(9)-dihet (CHEBI:229814) is a hydroxy fatty acid (CHEBI:24654) |
| (+/-)8(9)-dihet (CHEBI:229814) is a polyunsaturated fatty acid (CHEBI:26208) |
| IUPAC Name |
|---|
| 8,9-dihydroxyicosa-5,11,14-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 21237700 | ChemSpider |