EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O5 |
| Net Charge | 0 |
| Average Mass | 324.377 |
| Monoisotopic Mass | 324.16852 |
| SMILES | CCN(CC)C(=O)CNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H24N2O5/c1-6-18(7-2)14(19)10-17-16(20)11-8-12(21-3)15(23-5)13(9-11)22-4/h8-9H,6-7,10H2,1-5H3,(H,17,20) |
| InChIKey | NLRFFZRHTICQBO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricetamide (CHEBI:229806) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[2-(diethylamino)-2-oxoethyl]-3,4,5-trimethoxybenzamide |