EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CCCCC/C=C\C/C=C\CC(O)/C=C\C=C\C/C=C\C(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-10-13-16-19(21)17-14-11-9-12-15-18-20(22)23/h6-7,9-11,13-15,17-19,21H,2-5,8,12,16H2,1H3,(H,22,23)/b7-6-,11-9+,13-10-,17-14-,18-15- |
| InChIKey | HYIMLVVUIPGBLR-MFUNBAKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS9087) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-hydroxy-2z,5e,7z,11z,14z-eicosapentaenoic acid (CHEBI:229796) is a HEPE (CHEBI:72799) |
| IUPAC Name |
|---|
| (2Z,5E,7Z,11Z,14Z)-9-hydroxyicosa-2,5,7,11,14-pentaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 7822574 | ChemSpider |
| LMFA01030717 | LIPID MAPS |