EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O3 |
| Net Charge | 0 |
| Average Mass | 140.138 |
| Monoisotopic Mass | 140.04734 |
| SMILES | O=C1C=CC(C(=O)O)CC1 |
| InChI | InChI=1S/C7H8O3/c8-6-3-1-5(2-4-6)7(9)10/h1,3,5H,2,4H2,(H,9,10) |
| InChIKey | JBSILJIXXSXXTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:229775) has functional parent 4-oxocyclohexanecarboxylic acid (CHEBI:1921) |
| 4-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:229775) is a 5-oxo monocarboxylic acid (CHEBI:35952) |
| 4-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:229775) is a cyclohexenecarboxylic acid (CHEBI:23483) |
| 4-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:229775) is a cyclohexenones (CHEBI:48953) |
| 4-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:229775) is conjugate acid of 4-oxocyclohex-2-ene-1-carboxylate (CHEBI:229702) |
| Incoming Relation(s) |
| 4-oxocyclohex-2-ene-1-carboxylate (CHEBI:229702) is conjugate base of 4-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:229775) |
| IUPAC Name |
|---|
| 4-oxocyclohex-2-ene-1-carboxylic acid |
| Synonym | Source |
|---|---|
| 4-oxo-2-cyclohexene-1-carboxylic acid | ChEBI |