EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13F3N4O5S |
| Net Charge | 0 |
| Average Mass | 406.342 |
| Monoisotopic Mass | 406.05588 |
| SMILES | COc1nc(OC)nc(C(=O)c2cccc(F)c2N(C)S(=O)(=O)C(F)F)n1 |
| InChI | InChI=1S/C14H13F3N4O5S/c1-21(27(23,24)12(16)17)9-7(5-4-6-8(9)15)10(22)11-18-13(25-2)20-14(19-11)26-3/h4-6,12H,1-3H3 |
| InChIKey | GBHVIWKSEHWFDD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triafamone (CHEBI:229766) has role agrochemical (CHEBI:33286) |
| triafamone (CHEBI:229766) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| triafamone (CHEBI:229766) has role herbicide (CHEBI:24527) |
| triafamone (CHEBI:229766) is a aromatic ketone (CHEBI:76224) |
| triafamone (CHEBI:229766) is a diether (CHEBI:46786) |
| triafamone (CHEBI:229766) is a methoxy-1,3,5-triazine (CHEBI:38177) |
| triafamone (CHEBI:229766) is a monofluorobenzenes (CHEBI:83575) |
| triafamone (CHEBI:229766) is a organofluorine compound (CHEBI:37143) |
| triafamone (CHEBI:229766) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-{2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)carbonyl]-6-fluorophenyl}-1,1-difluoro-N-methylmethanesulfonamide |
| Synonyms | Source |
|---|---|
| 2'-[(4,6-dimethoxy-1,3,5-triazin-2-yl)carbonyl]-1,1,6'-trifluoro-N-methylmethanesulfonanilide | Alan Wood's Pesticides |
| AE 1887198 | PPDB |
| BCS-BX60309 | ChEBI |
| N-[2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)carbonyl]-6-fluorophenyl]-1,1-difluoro-N-methylmethanesulfonamide | Alan Wood's Pesticides |
| N-{2-[4,6-dimethoxy(1,3,5-triazine-2-carbonyl)]-6-fluorophenyl}-1,1-difluoro-N-methylmethanesulfonamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 2920 | PPDB |
| triafamone | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:874195-61-6 | Alan Wood's Pesticides |
| Citations |
|---|