EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15F6N5O3S |
| Net Charge | 0 |
| Average Mass | 519.427 |
| Monoisotopic Mass | 519.07998 |
| SMILES | CS(=O)(=O)Nc1ccc(/C(=C\n2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C(N)=O)cc1 |
| InChI | InChI=1S/C20H15F6N5O3S/c1-35(33,34)30-15-4-2-11(3-5-15)16(17(27)32)9-31-10-28-18(29-31)12-6-13(19(21,22)23)8-14(7-12)20(24,25)26/h2-10,30H,1H3,(H2,27,32)/b16-9+ |
| InChIKey | WULLCOQWAPGBSM-CXUHLZMHSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. exportin 1 inhibitor Any inhibitor of exportin 1. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XPO1-IN-1 (CHEBI:229765) has role antineoplastic agent (CHEBI:35610) |
| XPO1-IN-1 (CHEBI:229765) has role apoptosis inducer (CHEBI:68495) |
| XPO1-IN-1 (CHEBI:229765) has role exportin 1 inhibitor (CHEBI:229763) |
| XPO1-IN-1 (CHEBI:229765) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| XPO1-IN-1 (CHEBI:229765) is a enamide (CHEBI:51751) |
| XPO1-IN-1 (CHEBI:229765) is a sulfonamide (CHEBI:35358) |
| XPO1-IN-1 (CHEBI:229765) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| (2E)-3-{3-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}-2-{4-[(methylsulfonyl)amino]phenyl}prop-2-enamide |
| Citations |
|---|