EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H11F6N7O |
| Net Charge | 0 |
| Average Mass | 443.311 |
| Monoisotopic Mass | 443.09293 |
| SMILES | O=C(/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)NNc1cnccn1 |
| InChI | InChI=1S/C17H11F6N7O/c18-16(19,20)11-5-10(6-12(7-11)17(21,22)23)15-26-9-30(29-15)4-1-14(31)28-27-13-8-24-2-3-25-13/h1-9H,(H,25,27)(H,28,31)/b4-1- |
| InChIKey | DEVSOMFAQLZNKR-RJRFIUFISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. exportin 1 inhibitor Any inhibitor of exportin 1. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selinexor (CHEBI:229764) has role anti-inflammatory agent (CHEBI:67079) |
| selinexor (CHEBI:229764) has role antineoplastic agent (CHEBI:35610) |
| selinexor (CHEBI:229764) has role apoptosis inducer (CHEBI:68495) |
| selinexor (CHEBI:229764) has role exportin 1 inhibitor (CHEBI:229763) |
| selinexor (CHEBI:229764) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| selinexor (CHEBI:229764) is a enamide (CHEBI:51751) |
| selinexor (CHEBI:229764) is a hydrazide (CHEBI:35362) |
| selinexor (CHEBI:229764) is a pyrazines (CHEBI:38314) |
| selinexor (CHEBI:229764) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| (2Z)-3-{3-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}-N'-(pyrazin-2-yl)prop-2-enehydrazide |
| INNs | Source |
|---|---|
| selinexor | WHO MedNet |
| selinexor | WHO MedNet |
| sélinexor | WHO MedNet |
| selinexorum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2Z)-3-{3-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1- yl}-N'-(pyrazin-2-yl)prop-2-enehydrazide | ChEBI |
| KPT 330 | DrugBank |
| KPT-330 | DrugBank |
| Brand Name | Source |
|---|---|
| Xpovio | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D11222 | KEGG DRUG |
| DB11942 | DrugBank |
| HMDB0258217 | HMDB |
| Selinexor | Wikipedia |
| Citations |
|---|