EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10F6N6O |
| Net Charge | 0 |
| Average Mass | 428.296 |
| Monoisotopic Mass | 428.08203 |
| SMILES | NC(=O)/C(=C/n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cncnc1 |
| InChI | InChI=1S/C17H10F6N6O/c18-16(19,20)11-1-9(2-12(3-11)17(21,22)23)15-27-8-29(28-15)6-13(14(24)30)10-4-25-7-26-5-10/h1-8H,(H2,24,30)/b13-6+ |
| InChIKey | JFBAVWVBLRIWHM-AWNIVKPZSA-N |
| Roles Classification |
|---|
| Biological Roles: | exportin 1 inhibitor Any inhibitor of exportin 1. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eltanexor (CHEBI:229762) has role antineoplastic agent (CHEBI:35610) |
| eltanexor (CHEBI:229762) has role apoptosis inducer (CHEBI:68495) |
| eltanexor (CHEBI:229762) has role exportin 1 inhibitor (CHEBI:229763) |
| eltanexor (CHEBI:229762) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| eltanexor (CHEBI:229762) is a enamide (CHEBI:51751) |
| eltanexor (CHEBI:229762) is a primary carboxamide (CHEBI:140324) |
| eltanexor (CHEBI:229762) is a pyrimidines (CHEBI:39447) |
| eltanexor (CHEBI:229762) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| (2E)-3-{3-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}-2-(pyrimidin-5-yl)prop-2-enamide |
| INNs | Source |
|---|---|
| eltanexor | WHO MedNet |
| eltanexor | WHO MedNet |
| eltanexor | WHO MedNet |
| eltanexorum | WHO MedNet |
| Synonyms | Source |
|---|---|
| ATG-016 | ChEBI |
| (E)-3-(3-(3,5-bis(trifluoromethyl)phenyl)-1,2,4-triazol-1-yl)-2-pyrimidin-5-ylprop-2-enamide | SUBMITTER |
| KPT 8602 | ChEBI |
| KPT-8602 | SUBMITTER |
| KPT8602 | ChEBI |
| ONO-7706 | ChEBI |
| Citations |
|---|