EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:229760 - flupyroxystrobin
| Formula | C17H14F3NO4 |
| Net Charge | 0 |
| Average Mass | 353.296 |
| Monoisotopic Mass | 353.08749 |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1Oc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C17H14F3NO4/c1-23-10-13(16(22)24-2)12-5-3-4-6-14(12)25-15-9-11(7-8-21-15)17(18,19)20/h3-10H,1-2H3/b13-10+ |
| InChIKey | SEEIKOSFZLBRHO-JLHYYAGUSA-N |
| Roles Classification |
|---|
| Biological Role: | quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. |
| Applications: | quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flupyroxystrobin (CHEBI:229760) has role insecticide (CHEBI:24852) |
| flupyroxystrobin (CHEBI:229760) has role quinone outside inhibitor (CHEBI:141153) |
| flupyroxystrobin (CHEBI:229760) is a aromatic ether (CHEBI:35618) |
| flupyroxystrobin (CHEBI:229760) is a enoate ester (CHEBI:51702) |
| flupyroxystrobin (CHEBI:229760) is a enol ether (CHEBI:47985) |
| flupyroxystrobin (CHEBI:229760) is a methyl ester (CHEBI:25248) |
| flupyroxystrobin (CHEBI:229760) is a organofluorine compound (CHEBI:37143) |
| flupyroxystrobin (CHEBI:229760) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| methyl (2E)-3-methoxy-2-(2-{[4-(trifluoromethyl)pyridin-2-yl]oxy}phenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| methyl (2E)-3-methoxy-2-(2-{[4-(trifluoromethyl)-2-pyridyl]oxy}phenyl)propenoate | Alan Wood's Pesticides |
| methyl (E)-α-(methoxymethylene)-2-[[4-(trifluoromethyl)-2-pyridinyl]oxy]benzeneacetate | Alan Wood's Pesticides |
| methyl (E)-3-methoxy-2-(2-{[4-(trifluoromethyl)-2-pyridyl]oxy}phenyl)acrylate | Alan Wood's Pesticides |
| SYN549888 | ChEBI |
| SYN 549888 | PPDB |