EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H13BrF12N2O5 |
| Net Charge | 0 |
| Average Mass | 741.279 |
| Monoisotopic Mass | 739.98162 |
| SMILES | CN(C(=O)c1ccc2c(c1)OC(F)(F)O2)c1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2OC(F)F)c1F |
| InChI | InChI=1S/C26H13BrF12N2O5/c1-41(21(43)10-5-6-15-16(7-10)46-26(38,39)45-15)14-4-2-3-12(18(14)28)20(42)40-19-13(27)8-11(9-17(19)44-22(29)30)23(31,24(32,33)34)25(35,36)37/h2-9,22H,1H3,(H,40,42) |
| InChIKey | BUCVOTBQHDVWAP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperflanilide (CHEBI:229755) is a aromatic ether (CHEBI:35618) |
| piperflanilide (CHEBI:229755) is a benzamides (CHEBI:22702) |
| piperflanilide (CHEBI:229755) is a benzodioxoles (CHEBI:38298) |
| piperflanilide (CHEBI:229755) is a bromobenzenes (CHEBI:37149) |
| piperflanilide (CHEBI:229755) is a monofluorobenzenes (CHEBI:83575) |
| piperflanilide (CHEBI:229755) is a organofluorine insecticide (CHEBI:38804) |
| piperflanilide (CHEBI:229755) is a secondary carboxamide (CHEBI:140325) |
| piperflanilide (CHEBI:229755) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-(3-{[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl}-2-fluorophenyl)-2,2-difluoro-N-methyl-1,3-benzodioxole-5-carboxamide |
| Synonyms | Source |
|---|---|
| N-[3-[[[2-bromo-6-(difluoromethoxy)-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]phenyl]amino]carbonyl]-2-fluorophenyl]-2,2-difluoro-N-methyl-1,3-benzodioxole-5-carboxamide | Alan Wood's Pesticides |
| N-[3-({2-bromo-6-(difluoromethoxy)-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]phenyl}carbamoyl)-2-fluorophenyl]-2,2-difluoro-N-methyl-1,3-benzodioxole-5-carboxamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| piperflanilide | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:2615135-05-0 | Alan Wood's Pesticides |