EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14ClF4NO2S |
| Net Charge | 0 |
| Average Mass | 407.816 |
| Monoisotopic Mass | 407.03699 |
| SMILES | COC(=O)c1ccccc1CNc1cc(SCC(F)(F)F)c(Cl)cc1F |
| InChI | InChI=1S/C17H14ClF4NO2S/c1-25-16(24)11-5-3-2-4-10(11)8-23-14-7-15(12(18)6-13(14)19)26-9-17(20,21)22/h2-7,23H,8-9H2,1H3 |
| InChIKey | WITOTVAOHGMELX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bentioflumin (CHEBI:229738) has role acaricide (CHEBI:22153) |
| bentioflumin (CHEBI:229738) is a aryl sulfide (CHEBI:35683) |
| bentioflumin (CHEBI:229738) is a benzoate ester (CHEBI:36054) |
| bentioflumin (CHEBI:229738) is a monochlorobenzenes (CHEBI:83403) |
| bentioflumin (CHEBI:229738) is a monofluorobenzenes (CHEBI:83575) |
| bentioflumin (CHEBI:229738) is a organofluorine compound (CHEBI:37143) |
| bentioflumin (CHEBI:229738) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| methyl 2-({4-chloro-2-fluoro-5-[(2,2,2-trifluoroethyl)sulfanyl]anilino}methyl)benzoate |
| Synonyms | Source |
|---|---|
| methyl 2-({4-chloro-2-fluoro-5-[(2,2,2-trifluoroethyl)thio]anilino}methyl)benzoate | Alan Wood's Pesticides |
| methyl 2-[[[4-chloro-2-fluoro-5-[(2,2,2-trifluoroethyl)thio]phenyl]amino]methyl]benzoate | Alan Wood's Pesticides |
| methyl α-{4-chloro-2-fluoro-5-[(2,2,2-trifluoroethyl)thio]anilino}toluate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| bentioflumin | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:2566451-67-8 | Alan Wood's Pesticides |