EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2O2 |
| Net Charge | 0 |
| Average Mass | 314.429 |
| Monoisotopic Mass | 314.19943 |
| SMILES | [H][C@@]12CC3=C[C@@]([H])(C(=O)CC3)[C@@]3([H])C=C(CCC3=O)C[C@@]([H])(CN1)N(C)C2 |
| InChI | InChI=1S/C19H26N2O2/c1-21-11-14-6-12-2-4-18(22)16(8-12)17-9-13(3-5-19(17)23)7-15(21)10-20-14/h8-9,14-17,20H,2-7,10-11H2,1H3/t14-,15-,16+,17+/m0/s1 |
| InChIKey | IKEHAWAEPHQJSM-MWDXBVQZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| herquline C (CHEBI:229729) has role Penicillium metabolite (CHEBI:76964) |
| herquline C (CHEBI:229729) is a alkaloid (CHEBI:22315) |
| herquline C (CHEBI:229729) is a cyclic ketone (CHEBI:3992) |
| herquline C (CHEBI:229729) is a organic heterotetracyclic compound (CHEBI:38163) |
| herquline C (CHEBI:229729) is a secondary amino compound (CHEBI:50995) |
| herquline C (CHEBI:229729) is a tertiary amino compound (CHEBI:50996) |
| herquline C (CHEBI:229729) is conjugate base of herquline C(1+) (CHEBI:229730) |
| Incoming Relation(s) |
| herquline C(1+) (CHEBI:229730) is conjugate acid of herquline C (CHEBI:229729) |
| IUPAC Name |
|---|
| (1S,7R,8R,14S)-15-methyl-15,17-diazatetracyclo[12.2.2.13,7.18,12]icosa-3(20),12(19)-diene-6,9-dione |
| Synonym | Source |
|---|---|
| (+)-herquline C | ChEBI |
| Citations |
|---|