EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O |
| Net Charge | 0 |
| Average Mass | 96.129 |
| Monoisotopic Mass | 96.05751 |
| SMILES | C1=CC2OC2CC1 |
| InChI | InChI=1S/C6H8O/c1-2-4-6-5(3-1)7-6/h1,3,5-6H,2,4H2 |
| InChIKey | ILSLNOWZSKKNJQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-epoxy-1-cyclohexene (CHEBI:229725) has functional parent cyclohexene (CHEBI:36404) |
| 3,4-epoxy-1-cyclohexene (CHEBI:229725) has role mutagen (CHEBI:25435) |
| 3,4-epoxy-1-cyclohexene (CHEBI:229725) has role rat metabolite (CHEBI:86264) |
| 3,4-epoxy-1-cyclohexene (CHEBI:229725) is a epoxide (CHEBI:32955) |
| 3,4-epoxy-1-cyclohexene (CHEBI:229725) is a olefinic compound (CHEBI:78840) |
| 3,4-epoxy-1-cyclohexene (CHEBI:229725) is a organic heterobicyclic compound (CHEBI:27171) |
| Incoming Relation(s) |
| cyclohex-3-ene-1,2-diol (CHEBI:231715) has functional parent 3,4-epoxy-1-cyclohexene (CHEBI:229725) |
| IUPAC Name |
|---|
| 7-oxabicyclo[4.1.0]hept-2-ene |
| Synonyms | Source |
|---|---|
| 1,2-epoxy-3,4-cyclohexene | ChEBI |
| 1,2-epoxy-3-cyclohexene | ChEBI |
| 1,3-cyclohexadiene monoepoxide | ChEBI |
| 1,3-cyclohexadiene monooxide | ChEBI |
| 1,3-cyclohexadiene oxide | ChEBI |
| 3,4-epoxycyclohex-1-ene | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,4-epoxy-1-cyclohexene | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:6705-51-7 | ChEBI |
| Citations |
|---|