EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N6O3 |
| Net Charge | 0 |
| Average Mass | 410.478 |
| Monoisotopic Mass | 410.20664 |
| SMILES | C[C@@H]1COCCN1c1cc([C@]2(O)C[C@H]3CC[C@@H](C2)O3)c2cnn(-c3ccnn3)c2n1 |
| InChI | InChI=1S/C21H26N6O3/c1-13-12-29-7-6-26(13)19-8-17(21(28)9-14-2-3-15(10-21)30-14)16-11-23-27(20(16)24-19)18-4-5-22-25-18/h4-5,8,11,13-15,28H,2-3,6-7,9-10,12H2,1H3,(H,22,25)/t13-,14-,15+,21+/m1/s1 |
| InChIKey | YIHHYCIYAIVQKX-MBIULKOWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| camonsertib (CHEBI:229722) has role antineoplastic agent (CHEBI:35610) |
| camonsertib (CHEBI:229722) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| camonsertib (CHEBI:229722) is a imidazoles (CHEBI:24780) |
| camonsertib (CHEBI:229722) is a morpholines (CHEBI:38785) |
| camonsertib (CHEBI:229722) is a oxabicycloalkane (CHEBI:46733) |
| camonsertib (CHEBI:229722) is a pyrazolopyridine (CHEBI:46699) |
| camonsertib (CHEBI:229722) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3-endo)-3-{6-[(3R)-3-methylmorpholin-4-yl]-1-(1H-pyrazol-3-yl)-1H-pyrazolo[3,4-b]pyridin-4-yl}-8-oxabicyclo[3.2.1]octan-3-ol |
| INNs | Source |
|---|---|
| camonsertib | WHO MedNet |
| camonsertib | WHO MedNet |
| camonsertib | WHO MedNet |
| camonsertibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| RP 3500 | ChEBI |
| RP-3500 | ChEBI |
| RP3500 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Camonsertib | Wikipedia |
| D12321 | KEGG DRUG |
| DB18888 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:2417489-10-0 | KEGG DRUG |
| Citations |
|---|