EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35N8O17P3S |
| Net Charge | 0 |
| Average Mass | 796.539 |
| Monoisotopic Mass | 796.10537 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSN=O |
| InChI | InChI=1S/C21H35N8O17P3S/c1-21(2,16(32)19(33)24-4-3-12(30)23-5-6-50-28-34)8-43-49(40,41)46-48(38,39)42-7-11-15(45-47(35,36)37)14(31)20(44-11)29-10-27-13-17(22)25-9-26-18(13)29/h9-11,14-16,20,31-32H,3-8H2,1-2H3,(H,23,30)(H,24,33)(H,38,39)(H,40,41)(H2,22,25,26)(H2,35,36,37)/t11-,14-,15-,16+,20-/m1/s1 |
| InChIKey | CNWRHTNOZSOAKE-IBOSZNHHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-nitroso-coenzyme A (CHEBI:229721) has functional parent coenzyme A (CHEBI:15346) |
| S-nitroso-coenzyme A (CHEBI:229721) is a nitrosothio compound (CHEBI:145545) |
| S-nitroso-coenzyme A (CHEBI:229721) is conjugate acid of S-nitroso-coenzyme A(4−) (CHEBI:145546) |
| Incoming Relation(s) |
| S-nitroso-coenzyme A(4−) (CHEBI:145546) is conjugate base of S-nitroso-coenzyme A (CHEBI:229721) |
| IUPAC Name |
|---|
| [(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)tetrahydrofuran-2-yl]methyl (3R)-3-hydroxy-2,2-dimethyl-4-[(3-{[2-(nitrososulfanyl)ethyl]amino}-3-oxopropyl)amino]-4-oxobutyl dihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| S-nitroso-CoA | ChEBI |
| S-nitrosocoenzyme A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:82494-50-6 | ChEBI |
| Citations |
|---|