EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O2 |
| Net Charge | 0 |
| Average Mass | 240.387 |
| Monoisotopic Mass | 240.20893 |
| SMILES | [H]C(CCCCC)=C([H])CCCCCCCC(=O)O |
| InChI | InChI=1S/C15H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h6-7H,2-5,8-14H2,1H3,(H,16,17) |
| InChIKey | DJCQJZKZUCHHAL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-pentadecenoic acid (CHEBI:229715) is a pentadecenoic acid (CHEBI:75088) |
| Incoming Relation(s) |
| (9E)-pentadecenoic acid (CHEBI:229717) is a 9-pentadecenoic acid (CHEBI:229715) |
| (9Z)-pentadecenoic acid (CHEBI:229716) is a 9-pentadecenoic acid (CHEBI:229715) |
| IUPAC Name |
|---|
| pentadec-9-enoic acid |
| Citations |
|---|