EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | CC1=C2C/C=C(\C)CC/C=C(/C)CC[C@@]1(C)[C@H](C)CC2 |
| InChI | InChI=1S/C20H32/c1-15-7-6-8-16(2)13-14-20(5)17(3)10-12-19(11-9-15)18(20)4/h8-9,17H,6-7,10-14H2,1-5H3/b15-9+,16-8-/t17-,20+/m1/s1 |
| InChIKey | OFPGTWLGIKEKRX-UJLTWOFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalotaxus sinensis (ncbitaxon:89484) | - | PubMed (37326357) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phomacta-1(15),3,7-triene (CHEBI:229698) has role plant metabolite (CHEBI:76924) |
| phomacta-1(15),3,7-triene (CHEBI:229698) is a carbobicyclic compound (CHEBI:36785) |
| phomacta-1(15),3,7-triene (CHEBI:229698) is a diterpene (CHEBI:35190) |
| phomacta-1(15),3,7-triene (CHEBI:229698) is a polycyclic olefin (CHEBI:35714) |
| IUPAC Name |
|---|
| (3E,11S,12R)-4,8,11,12,15-pentamethylbicyclo[9.3.1]pentadeca-1(15),3,7-triene |
| Citations |
|---|