EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N4O6 |
| Net Charge | -2 |
| Average Mass | 586.689 |
| Monoisotopic Mass | 586.28023 |
| SMILES | CCC1=C(C)/C(=C/c2nc(Cc3nc(/C=C4\NC(=O)C(C)=C4CC)c(C)c3CCC(=O)[O-])c(CCC(=O)[O-])c2C)NC1=O |
| InChI | InChI=1S/C33H40N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h13-14,34-35H,7-12,15H2,1-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/p-2/b26-13-,27-14- |
| InChIKey | HVHKMUMXERBUAN-IFADSCNNSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z,15Z)-mesobilirubin IXα(2−) (CHEBI:229696) is a dicarboxylic acid dianion (CHEBI:28965) |
| (4Z,15Z)-mesobilirubin IXα(2−) (CHEBI:229696) is a linear tetrapyrrole anion (CHEBI:59252) |
| (4Z,15Z)-mesobilirubin IXα(2−) (CHEBI:229696) is conjugate base of mesobilirubin IXα (CHEBI:25208) |
| Incoming Relation(s) |
| mesobilirubin IXα (CHEBI:25208) is conjugate acid of (4Z,15Z)-mesobilirubin IXα(2−) (CHEBI:229696) |
| UniProt Name | Source |
|---|---|
| (4Z,15Z)-mesobilirubin IXα | UniProt |