EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@]12CC=C(C)[C@@]([H])(CC/C(C)=C\CC/C(C)=C/C1)C2(C)C |
| InChI | InChI=1S/C20H32/c1-15-7-6-8-16(2)10-14-19-17(3)11-13-18(12-9-15)20(19,4)5/h8-9,11,18-19H,6-7,10,12-14H2,1-5H3/b15-9+,16-8-/t18-,19-/m1/s1 |
| InChIKey | QNMSLJUGAUPVTC-ZNOGWTIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalotaxus sinensis (ncbitaxon:89484) | - | PubMed (37326357) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| verticilla-3,7,12(13)-triene (CHEBI:229695) has role plant metabolite (CHEBI:76924) |
| verticilla-3,7,12(13)-triene (CHEBI:229695) is a carbobicyclic compound (CHEBI:36785) |
| verticilla-3,7,12(13)-triene (CHEBI:229695) is a diterpene (CHEBI:35190) |
| verticilla-3,7,12(13)-triene (CHEBI:229695) is a polycyclic olefin (CHEBI:35714) |
| IUPAC Name |
|---|
| (1R,3E,11R)-4,8,12,15,15-pentamethylbicyclo[9.3.1]pentadeca-3,7,12-triene |
| Citations |
|---|