EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@]12CC[C@@H](C)[C@]3(C)CC[C@]4(C)CCC=C(C)[C@@]([H])(C1)[C@]4([H])[C@]23[H] |
| InChI | InChI=1S/C20H32/c1-13-6-5-9-19(3)10-11-20(4)14(2)7-8-15-12-16(13)18(19)17(15)20/h6,14-18H,5,7-12H2,1-4H3/t14-,15+,16-,17+,18-,19+,20+/m1/s1 |
| InChIKey | VPEXEKPLIFYXOK-PHUPPTAPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalotaxus sinensis (ncbitaxon:89484) | - | PubMed (37326357) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephalot-3(4)-ene (CHEBI:229693) has role plant metabolite (CHEBI:76924) |
| cephalot-3(4)-ene (CHEBI:229693) is a carbotetracyclic compound (CHEBI:177332) |
| cephalot-3(4)-ene (CHEBI:229693) is a diterpene (CHEBI:35190) |
| cephalot-3(4)-ene (CHEBI:229693) is a polycyclic olefin (CHEBI:35714) |
| IUPAC Name |
|---|
| (1R,3aS,4aS,8aS,10aS,10bS,10cR)-1,5,8a,10a-tetramethyl-1,2,3,3a,4,4a,7,8,8a,9,10,10a,10b,10c-tetradecahydrocyclohepta[bc]acenaphthylene |
| Synonym | Source |
|---|---|
| cephalotene | SUBMITTER |
| Citations |
|---|