EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O9 |
| Net Charge | 0 |
| Average Mass | 554.721 |
| Monoisotopic Mass | 554.34548 |
| SMILES | [H][C@@]12C[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C30H50O9/c1-15(4-7-23(33)34)18-5-6-19-24-20(9-11-30(18,19)3)29(2)10-8-17(12-16(29)13-21(24)32)38-28-27(37)26(36)25(35)22(14-31)39-28/h15-22,24-28,31-32,35-37H,4-14H2,1-3H3,(H,33,34)/t15-,16+,17-,18-,19+,20+,21-,22-,24+,25-,26+,27-,28-,29+,30-/m1/s1 |
| InChIKey | QRLIJDGVRXVHQD-UVMPBBQUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chenodeoxycholic acid-3-O-β-D-glucoside (CHEBI:229688) has functional parent chenodeoxycholic acid (CHEBI:16755) |
| chenodeoxycholic acid-3-O-β-D-glucoside (CHEBI:229688) is a 7α-hydroxy steroid (CHEBI:36843) |
| chenodeoxycholic acid-3-O-β-D-glucoside (CHEBI:229688) is a monosaccharide derivative (CHEBI:63367) |
| chenodeoxycholic acid-3-O-β-D-glucoside (CHEBI:229688) is a β-D-glucoside (CHEBI:22798) |
| chenodeoxycholic acid-3-O-β-D-glucoside (CHEBI:229688) is conjugate acid of chenodeoxycholate-3-O-β-D-glucoside(1−) (CHEBI:142610) |
| Incoming Relation(s) |
| chenodeoxycholate-3-O-β-D-glucoside(1−) (CHEBI:142610) is conjugate base of chenodeoxycholic acid-3-O-β-D-glucoside (CHEBI:229688) |
| IUPAC Name |
|---|
| 3α-(β-D-glucopyranosyloxy)-7α-hydroxy-5β-cholan-24-oic acid |
| Synonym | Source |
|---|---|
| 3β-D-glucosido-chenodeoxycholic acid | ChEBI |
| Citations |
|---|