EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44F2N2O3 |
| Net Charge | 0 |
| Average Mass | 554.722 |
| Monoisotopic Mass | 554.33200 |
| SMILES | [H][C@@]12CC(C)(C)CC[C@]1(NC(=O)C(C)(F)F)CC[C@]1(C)[C@]2([H])C(=O)C=C2[C@@]3(C)C=C(C#N)C(=O)C(C)(C)[C@]3([H])CC[C@]21C |
| InChI | InChI=1S/C33H44F2N2O3/c1-27(2)11-13-33(37-26(40)32(8,34)35)14-12-31(7)24(20(33)17-27)21(38)15-23-29(5)16-19(18-36)25(39)28(3,4)22(29)9-10-30(23,31)6/h15-16,20,22,24H,9-14,17H2,1-8H3,(H,37,40)/t20-,22-,24-,29-,30+,31+,33-/m0/s1 |
| InChIKey | RJCWBNBKOKFWNY-IDPLTSGASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| omaveloxolone (CHEBI:229661) has parent hydride oleanane (CHEBI:36481) |
| omaveloxolone (CHEBI:229661) has role anti-inflammatory agent (CHEBI:67079) |
| omaveloxolone (CHEBI:229661) has role antineoplastic agent (CHEBI:35610) |
| omaveloxolone (CHEBI:229661) has role antioxidant (CHEBI:22586) |
| omaveloxolone (CHEBI:229661) has role cardioprotective agent (CHEBI:77307) |
| omaveloxolone (CHEBI:229661) is a cyclic terpene ketone (CHEBI:36130) |
| omaveloxolone (CHEBI:229661) is a nitrile (CHEBI:18379) |
| omaveloxolone (CHEBI:229661) is a organofluorine compound (CHEBI:37143) |
| omaveloxolone (CHEBI:229661) is a pentacyclic triterpenoid (CHEBI:25872) |
| omaveloxolone (CHEBI:229661) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[(4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,6a,6b,7,8,8a,9,10,12a,14,14a,14b-hexadecahydropicen-4a(2H)-yl]-2,2-difluoropropanamide |
| INNs | Source |
|---|---|
| omaveloxolona | WHO MedNet |
| omaveloxolone | WHO MedNet |
| omavéloxolone | WHO MedNet |
| omaveloxolonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-(2-cyano-3,12-dioxo-28-noroleana-1,9(11)-dien-17-yl)-2,2-difluoropropanamide | ChEBI |
| RTA 408 | DrugBank |
| RTA-408 | DrugBank |
| RTA408 | ChEBI |
| Brand Name | Source |
|---|---|
| Skyclarys | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D10964 | KEGG DRUG |
| DB12513 | DrugBank |
| Omaveloxolone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1474034-05-3 | DrugBank |
| Citations |
|---|