EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14Cl3F6N3O3S |
| Net Charge | 0 |
| Average Mass | 596.764 |
| Monoisotopic Mass | 594.97256 |
| SMILES | Cc1cc(C2=NO[C@@](c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)sc1C(=O)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C20H14Cl3F6N3O3S/c1-8-2-13(36-16(8)17(34)30-6-14(33)31-7-19(24,25)26)12-5-18(35-32-12,20(27,28)29)9-3-10(21)15(23)11(22)4-9/h2-4H,5-7H2,1H3,(H,30,34)(H,31,33)/t18-/m0/s1 |
| InChIKey | HDKWFBCPLKNOCK-SFHVURJKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lotilaner (CHEBI:229657) has role ectoparasiticide (CHEBI:38956) |
| lotilaner (CHEBI:229657) has role GABA-gated chloride channel antagonist (CHEBI:38999) |
| lotilaner (CHEBI:229657) has role ophthalmology drug (CHEBI:66981) |
| lotilaner (CHEBI:229657) is a isoxazoles (CHEBI:55373) |
| lotilaner (CHEBI:229657) is a organofluorine compound (CHEBI:37143) |
| lotilaner (CHEBI:229657) is a secondary carboxamide (CHEBI:140325) |
| lotilaner (CHEBI:229657) is a thiophenes (CHEBI:26961) |
| lotilaner (CHEBI:229657) is a trichlorobenzene (CHEBI:27096) |
| IUPAC Name |
|---|
| 3-methyl-N-{2-oxo-2-[(2,2,2-trifluoroethyl)amino]ethyl}-5-[(5S)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-3-yl]thiophene-2-carboxamide |
| INNs | Source |
|---|---|
| lotilaner | WHO MedNet |
| lotilaner | WHO MedNet |
| lotilaner | WHO MedNet |
| lotilanerum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-[(5S)-4,5-dihydro-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-3-isoxazolyl]-3-methyl-N-[2-oxo-2-[(2,2,2-trifluoroethyl)amino]ethyl]-2-thiophenecarboxamide | ChEBI |
| TP 03 | DrugBank |
| TP-03 | DrugBank |
| TP03 | DrugBank |
| Brand Names | Source |
|---|---|
| Credelio | ChEBI |
| Xdemvy | KEGG DRUG |
| Citations |
|---|