EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N2O4 |
| Net Charge | 0 |
| Average Mass | 422.525 |
| Monoisotopic Mass | 422.22056 |
| SMILES | [H][C@@]1(c2ccc(C(=O)O)cc2)C[C@@H](OCC)CCN1Cc1c(OC)cc(C)c2nccc12 |
| InChI | InChI=1S/C25H30N2O4/c1-4-31-19-10-12-27(22(14-19)17-5-7-18(8-6-17)25(28)29)15-21-20-9-11-26-24(20)16(2)13-23(21)30-3/h5-9,11,13,19,22,26H,4,10,12,14-15H2,1-3H3,(H,28,29)/t19-,22-/m0/s1 |
| InChIKey | RENRQMCACQEWFC-UGKGYDQZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | complement factor B inhibitor Any inhibitor of complement factor B. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Application: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iptacopan (CHEBI:229652) has role complement factor B inhibitor (CHEBI:229655) |
| iptacopan (CHEBI:229652) has role immunomodulator (CHEBI:50846) |
| iptacopan (CHEBI:229652) is a benzoic acids (CHEBI:22723) |
| iptacopan (CHEBI:229652) is a diether (CHEBI:46786) |
| iptacopan (CHEBI:229652) is a ether (CHEBI:25698) |
| iptacopan (CHEBI:229652) is a indoles (CHEBI:24828) |
| iptacopan (CHEBI:229652) is a monocarboxylic acid (CHEBI:25384) |
| iptacopan (CHEBI:229652) is a piperidines (CHEBI:26151) |
| iptacopan (CHEBI:229652) is a tertiary amino compound (CHEBI:50996) |
| iptacopan (CHEBI:229652) is conjugate base of iptacopan(1+) (CHEBI:229656) |
| Incoming Relation(s) |
| iptacopan(1+) (CHEBI:229656) is conjugate acid of iptacopan (CHEBI:229652) |
| IUPAC Name |
|---|
| 4-{(2S,4S)-4-ethoxy-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl}benzoic acid |
| INNs | Source |
|---|---|
| iptacopan | WHO MedNet |
| iptacopan | WHO MedNet |
| iptacopán | WHO MedNet |
| iptacopanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| LNP 023 | DrugBank |
| LNP-023 | DrugBank |
| LNP023 | DrugBank |
| NVP-LNP023 | DrugBank |
| Citations |
|---|