EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25F3N6O2.H3O4P |
| Net Charge | 0 |
| Average Mass | 548.459 |
| Monoisotopic Mass | 548.17600 |
| SMILES | CCC(=O)N1CC[C@H](Nc2ncnc3c2CN(c2cnc(OC)c(C(F)(F)F)c2)CC3)C1.O=P(O)(O)O |
| InChI | InChI=1S/C21H25F3N6O2.H3O4P/c1-3-18(31)30-6-4-13(10-30)28-19-15-11-29(7-5-17(15)26-12-27-19)14-8-16(21(22,23)24)20(32-2)25-9-14;1-5(2,3)4/h8-9,12-13H,3-7,10-11H2,1-2H3,(H,26,27,28);(H3,1,2,3,4)/t13-;/m0./s1 |
| InChIKey | XXEDEGOAYSGNPS-ZOWNYOTGSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.153 (phosphatidylinositol-4,5-bisphosphate 3-kinase) inhibitor Any EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of phosphatidylinositol-4,5-bisphosphate 3-kinase (EC 2.7.1.153). immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Application: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leniolisib phosphate (CHEBI:229650) has part leniolisib (CHEBI:229649) |
| leniolisib phosphate (CHEBI:229650) has role EC 2.7.1.153 (phosphatidylinositol-4,5-bisphosphate 3-kinase) inhibitor (CHEBI:229651) |
| leniolisib phosphate (CHEBI:229650) has role immunomodulator (CHEBI:50846) |
| leniolisib phosphate (CHEBI:229650) is a phosphate salt (CHEBI:37853) |
| IUPAC Name |
|---|
| 1-[(3S)-3-({6-[6-methoxy-5-(trifluoromethyl)pyridin-3-yl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl}amino)pyrrolidin-1-yl]propan-1-one phosphate |
| Synonym | Source |
|---|---|
| phosphoric acid—1-[(3S)-3-({6-[6-methoxy-5-(trifluoromethyl)pyridin-3-yl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl}amino)pyrrolidin-1-yl]propan-1-one (1/1) | IUPAC |
| Brand Name | Source |
|---|---|
| Joenja | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D11159 | KEGG DRUG |
| DBSALT003336 | DrugBank |
| Citations |
|---|