EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29N5O2.HCl |
| Net Charge | 0 |
| Average Mass | 395.935 |
| Monoisotopic Mass | 395.20880 |
| SMILES | CC1(C)CC(=O)N(CCCCN2CCN(c3ncccn3)CC2)C(=O)C1.Cl |
| InChI | InChI=1S/C19H29N5O2.ClH/c1-19(2)14-16(25)24(17(26)15-19)9-4-3-8-22-10-12-23(13-11-22)18-20-6-5-7-21-18;/h5-7H,3-4,8-15H2,1-2H3;1H |
| InChIKey | DGOCVISYYYQFEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gepirone hydrochloride (CHEBI:229646) has part gepirone(1+) (CHEBI:229647) |
| gepirone hydrochloride (CHEBI:229646) has role antidepressant (CHEBI:35469) |
| gepirone hydrochloride (CHEBI:229646) has role anxiolytic drug (CHEBI:35474) |
| gepirone hydrochloride (CHEBI:229646) has role serotonergic agonist (CHEBI:35941) |
| gepirone hydrochloride (CHEBI:229646) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4,4-dimethyl-1-{4-[4-(pyrimidin-2-yl)piperazin-1-yl]butyl}piperidine-2,6-dione hydrochloride |
| Synonyms | Source |
|---|---|
| gepirone HCl | ChEBI |
| 4,4-dimethyl-1-{4-[4-(pyrimidin-2-yl)piperazin-1-yl]butyl}piperidine-2,6-dione—hydrogen chloride | IUPAC |
| 1-[4-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)butyl]-4-(pyrimidin-2-yl)piperazin-1-ium chloride | IUPAC |
| Org 33062 | ChEBI |
| BMY 13805 | ChEBI |
| MJ 13805 | ChEBI |
| Brand Name | Source |
|---|---|
| Exxua | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D04314 | KEGG DRUG |
| DBSALT002148 | DrugBank |
| EP1343504 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:83928-66-9 | DrugBank |
| Citations |
|---|