EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H46N8O3 |
| Net Charge | 0 |
| Average Mass | 638.817 |
| Monoisotopic Mass | 638.36929 |
| SMILES | Cc1cc(C[C@@H](NC(=O)N2CCC(c3cc4ccccc4nc3=O)CC2)C(=O)N2CCN(C3CCN(C)CC3)CC2)cc2cnnc12 |
| InChI | InChI=1S/C36H46N8O3/c1-24-19-25(20-28-23-37-40-33(24)28)21-32(35(46)43-17-15-42(16-18-43)29-9-11-41(2)12-10-29)39-36(47)44-13-7-26(8-14-44)30-22-27-5-3-4-6-31(27)38-34(30)45/h3-6,19-20,22-23,26,29,32H,7-18,21H2,1-2H3,(H,37,40)(H,38,45)(H,39,47)/t32-/m1/s1 |
| InChIKey | JJVAPHYEOZSKJZ-JGCGQSQUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | calcitonin gene-related peptide receptor antagonist An antagonist at any calcitonin gene-related peptide receptor. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zavegepant (CHEBI:229643) has role anti-asthmatic agent (CHEBI:65023) |
| zavegepant (CHEBI:229643) has role antiviral agent (CHEBI:22587) |
| zavegepant (CHEBI:229643) has role calcitonin gene-related peptide receptor antagonist (CHEBI:196956) |
| zavegepant (CHEBI:229643) is a N-acylpiperazine (CHEBI:46844) |
| zavegepant (CHEBI:229643) is a N-carbamoyl-amino acid (CHEBI:21689) |
| zavegepant (CHEBI:229643) is a indazoles (CHEBI:38769) |
| zavegepant (CHEBI:229643) is a organic molecular entity (CHEBI:50860) |
| zavegepant (CHEBI:229643) is a piperidinecarboxamide (CHEBI:48592) |
| zavegepant (CHEBI:229643) is a piperidines (CHEBI:26151) |
| zavegepant (CHEBI:229643) is a quinolone (CHEBI:23765) |
| zavegepant (CHEBI:229643) is a ureas (CHEBI:47857) |
| zavegepant (CHEBI:229643) is conjugate base of zavegepant(1+) (CHEBI:229645) |
| Incoming Relation(s) |
| zavegepant(1+) (CHEBI:229645) is conjugate acid of zavegepant (CHEBI:229643) |
| IUPAC Name |
|---|
| N-{(2R)-3-(7-methyl-1H-indazol-5-yl)-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-1-oxopropan-2-yl}-4-(2-oxo-1,2-dihydroquinolin-3-yl)piperidine-1-carboxamide |
| INNs | Source |
|---|---|
| zavegepant | WHO MedNet |
| zavegepant | WHO MedNet |
| zavégépant | WHO MedNet |
| zavegepantum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BHV 3500 | ChEBI |
| BHV-3500 | DrugBank |
| BHV3500 | ChEBI |
| BMS 742413 | ChEBI |
| BMS-742413 | DrugBank |
| BMS-742413-01 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D11898 | KEGG DRUG |
| DB15688 | DrugBank |
| US2012059017 | Patent |
| Zavegepant | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1337918-83-8 | DrugBank |
| Citations |
|---|