EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H35NO2 |
| Net Charge | 0 |
| Average Mass | 273.461 |
| Monoisotopic Mass | 273.26678 |
| SMILES | CCCCCCCCCCCCN(CCO)CCO |
| InChI | InChI=1S/C16H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-17(13-15-18)14-16-19/h18-19H,2-16H2,1H3 |
| InChIKey | NKFNBVMJTSYZDV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-lauryldiethanolamine (CHEBI:229635) has functional parent dodecylamine (CHEBI:193593) |
| N-lauryldiethanolamine (CHEBI:229635) has role antibacterial agent (CHEBI:33282) |
| N-lauryldiethanolamine (CHEBI:229635) is a aminodiol (CHEBI:22501) |
| N-lauryldiethanolamine (CHEBI:229635) is a primary alcohol (CHEBI:15734) |
| N-lauryldiethanolamine (CHEBI:229635) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2,2'-(dodecylimino)diethanol |
| Synonyms | Source |
|---|---|
| 2,2'-(dodecylazanediyl)di(ethan-1-ol) | IUPAC |
| 2,2'-(dodecylazanediyl)diethanol | ChEBI |
| 2-[dodecyl(2-hydroxyethyl)amino]ethan-1-ol | ChEBI |
| 2-[dodecyl(2-hydroxyethyl)amino]ethanol | ChEBI |
| bis(2-hydroxyethyl)dodecylamine | ChEBI |
| bis(2-hydroxyethyl)laurylamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| KR20070079097 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1765726 | Reaxys |
| CAS:1541-67-9 | NIST Chemistry WebBook |
| Citations |
|---|