EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2.HCl |
| Net Charge | 0 |
| Average Mass | 210.708 |
| Monoisotopic Mass | 210.09238 |
| SMILES | Cc1ccc2ncc(CCN)c2c1.Cl |
| InChI | InChI=1S/C11H14N2.ClH/c1-8-2-3-11-10(6-8)9(4-5-12)7-13-11;/h2-3,6-7,13H,4-5,12H2,1H3;1H |
| InChIKey | RBHDFGBPJGEYCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Application: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyltryptamine hydrochloride (CHEBI:229634) has part tryptaminium (CHEBI:57887) |
| 5-methyltryptamine hydrochloride (CHEBI:229634) has role serotonergic agonist (CHEBI:35941) |
| 5-methyltryptamine hydrochloride (CHEBI:229634) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-(5-methyl-1H-indol-3-yl)ethanamine hydrochloride |
| Synonyms | Source |
|---|---|
| 2-(5-methyl-1H-indol-3-yl)ethan-1-amine hydrochloride | ChEBI |
| 2-(5-methyl-1H-indol-3-yl)ethan-1-amine—hydrogen chloride | IUPAC |
| 3-(2-aminoethyl)-5-methylindole hydrochloride | ChEBI |
| 3-(2-aminoethyl)-5-methylindole monohydrochloride | ChEBI |
| 5-methyl-1H-indole-3-ethylamine monohydrochloride | ChEBI |
| 5-methyltryptamine HCl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1010-95-3 | ChEBI |