EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:229632 - 4'-aminoacetanilide
| Formula | C8H10N2O |
| Net Charge | 0 |
| Average Mass | 150.181 |
| Monoisotopic Mass | 150.07931 |
| SMILES | CC(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C8H10N2O/c1-6(11)10-8-4-2-7(9)3-5-8/h2-5H,9H2,1H3,(H,10,11) |
| InChIKey | CHMBIJAOCISYEW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus cereus (ncbitaxon:1396) | - | PubMed (17368397) | Strain: 10-L-2 |
| Homo sapiens (ncbitaxon:9606) | Urine (NCIT:C13283) | PubMed (27215443) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-aminoacetanilide (CHEBI:229632) has functional parent 1,4-phenylenediamine (CHEBI:51403) |
| 4'-aminoacetanilide (CHEBI:229632) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 4'-aminoacetanilide (CHEBI:229632) has role human urinary metabolite (CHEBI:84087) |
| 4'-aminoacetanilide (CHEBI:229632) has role human xenobiotic metabolite (CHEBI:76967) |
| 4'-aminoacetanilide (CHEBI:229632) is a acetamides (CHEBI:22160) |
| 4'-aminoacetanilide (CHEBI:229632) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N-(4-aminophenyl)acetamide |
| Synonyms | Source |
|---|---|
| N-acetyl-p-phenylenediamine | ChEBI |
| C.I. 76005 | NIST Chemistry WebBook |
| p-acetamidoaniline | NIST Chemistry WebBook |
| acetyl-p-phenylenediamine | NIST Chemistry WebBook |
| C.I. oxidation base 19 | NIST Chemistry WebBook |
| fourrine A | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 4-Aminoacetanilide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:742888 | Reaxys |
| CAS:122-80-5 | NIST Chemistry WebBook |
| Citations |
|---|