EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CO3.2H4N |
| Net Charge | 0 |
| Average Mass | 96.086 |
| Monoisotopic Mass | 96.05349 |
| SMILES | O=C([O-])[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/CH2O3.2H3N/c2-1(3)4;;/h(H2,2,3,4);2*1H3 |
| InChIKey | PRKQVKDSMLBJBJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Applications: | raising agent A food additive which liberates gas so as to increase the volume of a dough or batter, resulting in a lighter and softer finished product. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ammonium carbonate (CHEBI:229630) has role food acidity regulator (CHEBI:64049) |
| ammonium carbonate (CHEBI:229630) has role raising agent (CHEBI:77971) |
| ammonium carbonate (CHEBI:229630) is a ammonium salt (CHEBI:47704) |
| ammonium carbonate (CHEBI:229630) is a carbonate salt (CHEBI:46721) |
| IUPAC Name |
|---|
| diammonium carbonate |
| Synonyms | Source |
|---|---|
| carbonic acid diammonium salt | ChEBI |
| Baker's ammonia | ChEBI |
| carbonic acid, ammonium salt (1:2) | ChEBI |
| salt of hartshorn | ChEBI |
| carbonic acid, diammonium salt | ChEBI |
| hartshorn | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Ammonium_carbonate | Wikipedia |
| DB15926 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:506-87-6 | ChEBI |
| Citations |
|---|