EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H17N3O6 |
| Net Charge | 0 |
| Average Mass | 419.393 |
| Monoisotopic Mass | 419.11174 |
| SMILES | C=CC(=O)N1C/C(=C\c2ccc([N+](=O)[O-])cc2)C(=O)/C(=C/c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H17N3O6/c1-2-21(26)23-13-17(11-15-3-7-19(8-4-15)24(28)29)22(27)18(14-23)12-16-5-9-20(10-6-16)25(30)31/h2-12H,1,13-14H2/b17-11+,18-12+ |
| InChIKey | GFARQYQBWJLZMW-JYFOCSDGSA-N |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| b-AP15 (CHEBI:229606) has role anti-inflammatory agent (CHEBI:67079) |
| b-AP15 (CHEBI:229606) has role antineoplastic agent (CHEBI:35610) |
| b-AP15 (CHEBI:229606) has role apoptosis inducer (CHEBI:68495) |
| b-AP15 (CHEBI:229606) has role proteasome inhibitor (CHEBI:52726) |
| b-AP15 (CHEBI:229606) is a acrylamides (CHEBI:22216) |
| b-AP15 (CHEBI:229606) is a nitrophenol (CHEBI:25562) |
| b-AP15 (CHEBI:229606) is a piperidones (CHEBI:48589) |
| IUPAC Name |
|---|
| (3E,5E)-3,5-bis(4-nitrobenzylidene)-1-(prop-2-enoyl)piperidin-4-one |
| Synonyms | Source |
|---|---|
| NSC687852 | SUBMITTER |
| NSC-687852 | ChEBI |
| NSC 687852 | ChEBI |
| (3E,5E)-1-acryloyl-3,5-bis(4-nitrobenzylidene)piperidin-4-one | ChEBI |
| 3E,5E-bis[(4-nitrophenyl)methylene]-1-(1-oxo-2-propen-1-yl)-4-piperidinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1009817-63-3 | ChEBI |
| Citations |
|---|