EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31ClN2 |
| Net Charge | 0 |
| Average Mass | 407.001 |
| Monoisotopic Mass | 406.21758 |
| SMILES | [H][C@@]12c3c(C(C)(C)C=C)nc4cccc(c34)C(C)(C)[C@@]1([H])C[C@@H](Cl)[C@](C)(C=C)[C@@H]2[N+]#[C-] |
| InChI | InChI=1S/C26H31ClN2/c1-9-24(3,4)22-21-19-15(12-11-13-17(19)29-22)25(5,6)16-14-18(27)26(7,10-2)23(28-8)20(16)21/h9-13,16,18,20,23,29H,1-2,14H2,3-7H3/t16-,18+,20-,23+,26-/m0/s1 |
| InChIKey | GHYIJWADNLIVDB-UMIISBCRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ambiguine A (CHEBI:229592) is a ambiguine (CHEBI:141618) |
| ambiguine A (CHEBI:229592) is a isocyanide (CHEBI:35353) |
| ambiguine A (CHEBI:229592) is a organic heterotetracyclic compound (CHEBI:38163) |
| UniProt Name | Source |
|---|---|
| ambiguine A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20775 | MetaCyc |
| Citations |
|---|