EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N3O6S.Na |
| Net Charge | 0 |
| Average Mass | 299.240 |
| Monoisotopic Mass | 299.01880 |
| SMILES | CC1=C[C@@H]2CN(C(=O)N2OS(=O)(=O)[O-])[C@@H]1C(N)=O.[Na+] |
| InChI | InChI=1S/C8H11N3O6S.Na/c1-4-2-5-3-10(6(4)7(9)12)8(13)11(5)17-18(14,15)16;/h2,5-6H,3H2,1H3,(H2,9,12)(H,14,15,16);/q;+1/p-1/t5-,6+;/m1./s1 |
| InChIKey | WHHNOICWPZIYKI-IBTYICNHSA-M |
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.2.6 (beta-lactamase) inhibitor An EC 3.5.2.* (non-peptide cyclic amide C-N hydrolase) inhibitor that interferes with the action of β-lactamase (EC 3.5.2.6). antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| durlobactam sodium (CHEBI:229544) has part durlobactam(1−) (CHEBI:229545) |
| durlobactam sodium (CHEBI:229544) has role antibacterial drug (CHEBI:36047) |
| durlobactam sodium (CHEBI:229544) has role EC 3.5.2.6 (β-lactamase) inhibitor (CHEBI:35625) |
| durlobactam sodium (CHEBI:229544) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| xacduro (CHEBI:229547) has part durlobactam sodium (CHEBI:229544) |
| IUPAC Name |
|---|
| sodium ({[(1R,2S,5R)-2-carbamoyl-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl]oxy}sulfonyl)oxidanide |
| Synonym | Source |
|---|---|
| ETX2514 sodium | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D11592 | KEGG DRUG |
| DBSALT003190 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1467157-21-6 | KEGG DRUG |
| Citations |
|---|