EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H40N4O5S |
| Net Charge | 0 |
| Average Mass | 592.762 |
| Monoisotopic Mass | 592.27194 |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2noc(C)c2C)c(COCC)c1 |
| InChI | InChI=1S/C32H40N4O5S/c1-5-7-14-29-33-32(17-10-11-18-32)31(37)36(29)20-24-15-16-26(25(19-24)21-40-6-2)27-12-8-9-13-28(27)42(38,39)35-30-22(3)23(4)41-34-30/h8-9,12-13,15-16,19H,5-7,10-11,14,17-18,20-21H2,1-4H3,(H,34,35) |
| InChIKey | WRFHGDPIDHPWIQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. endothelin A receptor antagonist A endothelin receptor antagonist is a drug which selectively blocks endothelin A receptors. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. endothelin A receptor antagonist A endothelin receptor antagonist is a drug which selectively blocks endothelin A receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sparsentan (CHEBI:229526) has role angiotensin receptor antagonist (CHEBI:61016) |
| sparsentan (CHEBI:229526) has role antihypertensive agent (CHEBI:35674) |
| sparsentan (CHEBI:229526) has role endothelin A receptor antagonist (CHEBI:51452) |
| sparsentan (CHEBI:229526) has role nephroprotective agent (CHEBI:76595) |
| sparsentan (CHEBI:229526) is a azaspiro compound (CHEBI:35624) |
| sparsentan (CHEBI:229526) is a benzyl ether (CHEBI:59859) |
| sparsentan (CHEBI:229526) is a biphenyls (CHEBI:22888) |
| sparsentan (CHEBI:229526) is a isoxazoles (CHEBI:55373) |
| sparsentan (CHEBI:229526) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4'-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-N-(4,5-dimethyl-1,2-oxazol-3-yl)-2'-(ethoxymethyl)[biphenyl]-2-sulfonamide |
| INNs | Source |
|---|---|
| esparsentán | WHO MedNet |
| sparsentan | WHO MedNet |
| sparsentan | WHO MedNet |
| sparsentanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-[4-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-(ethoxymethyl)phenyl]-N-(4,5-dimethyl-1,2-oxazol-3-yl)benzenesulfonamide | ChEBI |
| PS 433540 | ChEBI |
| PS-433540 | DrugBank |
| PS433540 | DrugBank |
| RE-021 | DrugBank |
| Brand Name | Source |
|---|---|
| Filspari | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D11776 | KEGG DRUG |
| DB12548 | DrugBank |
| Sparsentan | Wikipedia |
| Citations |
|---|