EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2S3 |
| Net Charge | 0 |
| Average Mass | 185.295 |
| Monoisotopic Mass | 184.96389 |
| SMILES | N[C@@H](CSSS)C(=O)O |
| InChI | InChI=1S/C3H7NO2S3/c4-2(3(5)6)1-8-9-7/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | WBUQYANSBCOQMP-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-trisulfanyl-L-alanine (CHEBI:229519) is a S-substituted L-cysteine (CHEBI:47910) |
| 3-trisulfanyl-L-alanine (CHEBI:229519) is tautomer of 3-trisulfanyl-L-alanine zwitterion (CHEBI:229465) |
| Incoming Relation(s) |
| 3-trisulfanyl-L-alanine residue (CHEBI:139319) is substituent group from 3-trisulfanyl-L-alanine (CHEBI:229519) |
| 3-trisulfanyl-L-alanine zwitterion (CHEBI:229465) is tautomer of 3-trisulfanyl-L-alanine (CHEBI:229519) |
| IUPAC Name |
|---|
| 3-trisulfanyl-L-alanine |
| Synonyms | Source |
|---|---|
| S-disulfanyl-L-cysteine | ChEBI |
| (2R)-2-amino-3-trisulfanylpropanoic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| TSY | PDBeChem |
| Citations |
|---|