EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N2O2 |
| Net Charge | 0 |
| Average Mass | 152.153 |
| Monoisotopic Mass | 152.05858 |
| SMILES | O=C(O)CCc1ncccn1 |
| InChI | InChI=1S/C7H8N2O2/c10-7(11)3-2-6-8-4-1-5-9-6/h1,4-5H,2-3H2,(H,10,11) |
| InChIKey | UXTNNDRHOGJJFE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS8090) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(pyrimidin-2-yl)propanoic acid (CHEBI:229507) has role human metabolite (CHEBI:77746) |
| 3-(pyrimidin-2-yl)propanoic acid (CHEBI:229507) is a monocarboxylic acid (CHEBI:25384) |
| 3-(pyrimidin-2-yl)propanoic acid (CHEBI:229507) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| 3-(pyrimidin-2-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| 3-pyrimidin-2-ylpropanoic acid | ChEBI |
| 3-pyrimidin-2-yl-propionic acid | SUBMITTER |
| pyrimidine-2-propionic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:439108-20-0 | ChEBI |
| Citations |
|---|