EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO5 |
| Net Charge | 0 |
| Average Mass | 191.183 |
| Monoisotopic Mass | 191.07937 |
| SMILES | C[C@@H](O)C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C7H13NO5/c1-3(9)5(7(12)13)8-6(11)4(2)10/h3-5,9-10H,1-2H3,(H,8,11)(H,12,13)/t3-,4-,5+/m1/s1 |
| InChIKey | NJAJXYAOBCLWCP-WDCZJNDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | HEK-293 cell (BTO:0000007) | MetaboLights (MTBLS6287) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-D-lactoylthreonine (CHEBI:229500) is a N-acyl-L-amino acid (CHEBI:21644) |
| Synonym | Source |
|---|---|
| D-Lac-Thr | SUBMITTER |