EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO4 |
| Net Charge | 0 |
| Average Mass | 203.238 |
| Monoisotopic Mass | 203.11576 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](C)O)C(=O)O |
| InChI | InChI=1S/C9H17NO4/c1-5(2)4-7(9(13)14)10-8(12)6(3)11/h5-7,11H,4H2,1-3H3,(H,10,12)(H,13,14)/t6-,7+/m1/s1 |
| InChIKey | BUMIGZVUJKNXCO-RQJHMYQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | HEK-293 cell (BTO:0000007) | MetaboLights (MTBLS6287) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-D-lactoylleucine (CHEBI:229499) is a N-acyl-L-amino acid (CHEBI:21644) |
| Synonym | Source |
|---|---|
| D-Lac-Leu | SUBMITTER |