EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO4S |
| Net Charge | 0 |
| Average Mass | 221.278 |
| Monoisotopic Mass | 221.07218 |
| SMILES | CSCC[C@H](NC(=O)[C@@H](C)O)C(=O)O |
| InChI | InChI=1S/C8H15NO4S/c1-5(10)7(11)9-6(8(12)13)3-4-14-2/h5-6,10H,3-4H2,1-2H3,(H,9,11)(H,12,13)/t5-,6+/m1/s1 |
| InChIKey | UFMNJPDGXQPVJM-RITPCOANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | HEK-293 cell (BTO:0000007) | MetaboLights (MTBLS6287) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-D-lactoylmethionine (CHEBI:229498) is a N-acyl-L-amino acid (CHEBI:21644) |
| Synonym | Source |
|---|---|
| D-Lac-Met | SUBMITTER |