EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4S |
| Net Charge | 0 |
| Average Mass | 193.224 |
| Monoisotopic Mass | 193.04088 |
| SMILES | C[C@@H](O)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H11NO4S/c1-3(8)5(9)7-4(2-12)6(10)11/h3-4,8,12H,2H2,1H3,(H,7,9)(H,10,11)/t3-,4+/m1/s1 |
| InChIKey | VPMRTVGJLYJTNF-DMTCNVIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | HEK-293 cell (BTO:0000007) | MetaboLights (MTBLS6287) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-D-lactoylcysteine (CHEBI:229495) is a N-acyl-L-amino acid (CHEBI:21644) |
| Synonym | Source |
|---|---|
| D-Lac-Cys | SUBMITTER |