EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO6 |
| Net Charge | 0 |
| Average Mass | 219.193 |
| Monoisotopic Mass | 219.07429 |
| SMILES | C[C@@H](O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H13NO6/c1-4(10)7(13)9-5(8(14)15)2-3-6(11)12/h4-5,10H,2-3H2,1H3,(H,9,13)(H,11,12)(H,14,15)/t4-,5+/m1/s1 |
| InChIKey | NAOMOQZOYKZXAQ-UHNVWZDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | HEK-293 cell (BTO:0000007) | MetaboLights (MTBLS6287) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-D-lactoylglutamic acid (CHEBI:229494) is a N-acyl-L-amino acid (CHEBI:21644) |
| Synonym | Source |
|---|---|
| D-Lac-Glu | SUBMITTER |