EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22BrFO2 |
| Net Charge | 0 |
| Average Mass | 357.263 |
| Monoisotopic Mass | 356.07872 |
| SMILES | CC(C)[C@]12CC[C@](C)(O1)[C@H](OCc1c(F)cccc1Br)C2 |
| InChI | InChI=1S/C17H22BrFO2/c1-11(2)17-8-7-16(3,21-17)15(9-17)20-10-12-13(18)5-4-6-14(12)19/h4-6,11,15H,7-10H2,1-3H3/t15-,16+,17-/m1/s1 |
| InChIKey | COHOXAPLFQQAGA-IXDOHACOSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R,4R)-cinflubrolin (CHEBI:229492) is a 2-[(2-bromo-6-fluorobenzyl)oxy]-1-methyl-4-(propan-2-yl)-7-oxabicyclo[2.2.1]heptane (CHEBI:229490) |
| Incoming Relation(s) |
| cinflubrolin (CHEBI:229487) has part (1S,2R,4R)-cinflubrolin (CHEBI:229492) |
| IUPAC Name |
|---|
| (1S,2R,4R)-2-[(2-bromo-6-fluorobenzyl)oxy]-1-methyl-4-(propan-2-yl)-7-oxabicyclo[2.2.1]heptane |
| Synonym | Source |
|---|---|
| (1S,2R,4R)-2-[(2-bromo-6-fluorophenyl)methoxy]-1-methyl-4-(propan-2-yl)-7-oxabicyclo[2.2.1]heptane | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:2984507-30-2 | ChEBI |